Kandi Raj CollegeDOWNLOAD : QUESTION PAPERS
| Description | Download |
| 2021-04-21 | |
| ⬢ 3rd SEM_Practical_SEC - geography - geo-h-sec-p-01-b |  |
| ⬢ 3rd SEM_Practical_SEC - geography - geo-h-sec-p-01-a | |
| ⬢ 3rd SEM_Practical_SEC - computer science - com.sc-h-sec-p-301 | |
| 2021-04-20 | |
| ⬢ 3rd SEM_Practical question from Dept. - botany - bot-h-cc-p-07 (ins) | |
| ⬢ 3rd SEM_Practical question from Dept. - botany - bot-h-ge-p-01 (ins) | |
| ⬢ 3rd SEM_Practical question from Dept. - Chemistry HGE_P_1 | |
| ⬢ 3rd SEM_Practical question from Dept. - Computer Science H GE | |
| ⬢ 3rd SEM_Practical question from Dept. - PHYSICS HCC CC7 | |
| ⬢ 3rd SEM_Practical question from Dept. - PHYSICS H-GE-P-01 | |
| ⬢ 3rd SEM_Practical question from Dept. - Physiology GE | |
| ⬢ 3rd SEM_Practical question from Dept. - Zoology H-GE-P-01 | |
| ⬢ 3rd SEM_Practical GE - zoology - zool-h-ge-p-01 | |
| ⬢ 3rd SEM_Practical GE - statistics - stat-h-ge-p-3 | |
| ⬢ 3rd SEM_Practical GE - physiology - physiol-h-ge-p-1 | |
| ⬢ 3rd SEM_Practical GE - physics - phy-h-ge-p-01 (electricity and magnetism) | |
| ⬢ 3rd SEM_Practical GE - Mol Bio - mbg101-p-cc-1 | |
| ⬢ 3rd SEM_Practical GE - geography - geo-h-ge-p-01-c | |
| ⬢ 3rd SEM_Practical GE - environmental science - envs-h-ge-p-03 | |
| ⬢ 3rd SEM_Practical GE - computer science - com.sc-h-ge-p-101 | |
| ⬢ 3rd SEM_Practical GE - chemistry - chem-h-ge-p-1 | |
| ⬢ 3rd SEM_Practical GE - botany - bot-h-ge-p-01 | |
| ⬢ 3rd SEM_Practical CC7 - mbbt - mbbt(h)303(p)-ccr-7 | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-16) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-15) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-14) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-13) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-12) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-11) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-10) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-9) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-8) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-7) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-6) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-5) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-4) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-3) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-2) | |
| ⬢ 3rd SEM_Practical CC7 - mathematics - math(h)-cc-p-07 (set-1) | |
| ⬢ 3rd SEM_Practical CC7 - environmental science - envs-h-cc-p-07 | |
| ⬢ 3rd SEM_Practical CC7 - chemistry - chem-h-cc-p-07 | |
| ⬢ 3rd SEM_Practical CC7 - botany - bot-h-cc-p-07 | |
| 2021-04-19 | |
| ⬢ 3rd SEM_Practical - zoology - zool-h-cc-p-05 | |
| ⬢ 3rd SEM_Practical - statistics - stat-h-cc-p-6 | |
| ⬢ 3rd SEM_Practical - physiology - physiol-h-cc-p-6 | |
| ⬢ 3rd SEM_Practical - physiology - physiol-h-cc-p-5 | |
| ⬢ 3rd SEM_Practical - physics - phy-h-cc-p-06 | |
| ⬢ 3rd SEM_Practical - physics - phy-h-cc-p-05 | |
| ⬢ 3rd SEM_Practical - microbiology - mb-h-cc-p-06 | |
| ⬢ 3rd SEM_Practical - microbiology - mb-h-cc-p-05 | |
| ⬢ 3rd SEM_Practical - mbbt - mbbt302(p)-ccr-6 | |
| ⬢ 3rd SEM_Practical - mbbt - mbbt301(p)-ccr-5 | |
| ⬢ 3rd SEM_Practical - geography - geoh-cc-p-06 | |
| ⬢ 3rd SEM_Practical - food & nutrition - f&n-h-cc-p-6 | |
| ⬢ 3rd SEM_Practical - environmental science - envs-h-cc-p-06 | |
| ⬢ 3rd SEM_Practical - environmental science - envs-h-cc-p-05 | |
| ⬢ 3rd SEM_Practical - computer science - com.sc-h-cc-306 | |
| ⬢ 3rd SEM_Practical - computer science - com.sc-h-cc-305 | |
| ⬢ 3rd SEM_Practical - chemistry - chem-h-cc-p-06 | |
| ⬢ 3rd SEM_Practical - chemistry - chem-h-cc-p-05 | |
| ⬢ 3rd SEM_Practical - botany - bot-h-cc-p-06 | |
| ⬢ 3rd SEM_Practical - botany - bot-h-cc-p-05 | |
| ⬢ 3rd SEM_Practical - botany - bot-h-cc-p-06 (ins) | |
| ⬢ 3rd SEM_Practical - botany - bot-h-cc-p-05 (ins) | |
| 2021-04-16 | |
| ⬢ Semester 3_PRACTICAL - Zoology GCC | |
| ⬢ Semester 3_PRACTICAL - Physiology | |
| ⬢ Semester 3_PRACTICAL - Physics | |
| ⬢ Semester 3_PRACTICAL - Physical Education SEC | |
| ⬢ Semester 3_PRACTICAL - Geography SEC | |
| ⬢ Semester 3_PRACTICAL - Geography GCC | |
| ⬢ Semester 3_PRACTICAL - COMPUTER SCIENCE PCC GEN | |
| ⬢ Semester 3_PRACTICAL - COMPUTER SCIENCE SEC | |
| ⬢ Semester 3_PRACTICAL - CHEMISTRY | |
| ⬢ Semester 3_PRACTICAL - BOTANY | |
| 2021-04-13 | |
| ⬢ Semester 3_INTERNAL - Zoology | |
| ⬢ Semester 3_INTERNAL - Sanskrit | |
| ⬢ Semester 3_INTERNAL - Political Science | |
| ⬢ Semester 3_INTERNAL - Physiology | |
| ⬢ Semester 3_INTERNAL - Physics | |
| ⬢ Semester 3_INTERNAL - Physical Education | |
| ⬢ Semester 3_INTERNAL - Philosophy | |
| ⬢ Semester 3_INTERNAL - Math | |
| ⬢ Semester 3_INTERNAL - History | |
| ⬢ Semester 3_INTERNAL - Geography | |
| ⬢ Semester 3_INTERNAL - English | |
| ⬢ Semester 3_INTERNAL - Education | |
| ⬢ Semester 3_INTERNAL - Computer Science | |
| ⬢ Semester 3_INTERNAL - Chemistry | |
| ⬢ Semester 3_INTERNAL - Botany | |
| ⬢ Semester 3_INTERNAL - Bengali | |
| 2021-04-12 | |
| ⬢ 3rd SEM_SEC_2nd Half - zoology - zool-g-sec-t-01 | |
| ⬢ 3rd SEM_SEC_2nd Half - urdu - urdp-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - sanskrit - sanp-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - political science - plsp-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - physiology - physiol-g-sec-t-01 | |
| ⬢ 3rd SEM_SEC_2nd Half - physics - phy-g-sec-t-1 (a-i) | |
| ⬢ 3rd SEM_SEC_2nd Half - philosophy - phil-p-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - molecular biology - mb-g-sec-t-1-101 | |
| ⬢ 3rd SEM_SEC_2nd Half - mathematics - math-g-sec-t-1 (a) & (b) | |
| ⬢ 3rd SEM_SEC_2nd Half - history - hisp-sec-t-1 (a) & (b) | |
| ⬢ 3rd SEM_SEC_2nd Half - hindi - hinp-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - english - engp-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - education - edcp-sec-t-1 (a) & (b) | |
| ⬢ 3rd SEM_SEC_2nd Half - economics - ecop-sec-t-1 | |
| ⬢ 3rd SEM_SEC_2nd Half - chemistry - chem-g-sec-t-1 (a) & (b) | |
| ⬢ 3rd SEM_SEC_2nd Half - botany - bot(g)-sec-t-01 (a) & (b) | |
| ⬢ 3rd SEM_SEC_2nd Half - bengali - beng-g-sec-t-1 | |
| ⬢ LCC-1_ENGLISH | |
| 2021-04-09 | |
| ⬢ 3rd semester 2nd half - sociology - socp-cc-t-3 | |
| ⬢ 3rd semester 2nd half - computer science - com.sc-g-cc-l-301c | |
| ⬢ 3rd semester 2nd half - computer science - com.sc-g-cc-l-301c (supple) | |
| ⬢ 3rd semester 1st half - physics - phyg-cc-3(a-c) | |
| ⬢ 3rd semester 1st half - history - hisp-cc-t-3 | |
| 2021-04-08 | |
| ⬢ 3rd semester 2nd half - political science - plsp-cc-t-3 | |
| ⬢ 3rd semester 2nd half - botany - bot-g-cc-t-03 | |
| ⬢ 3rd semester 1st half - physical education - pedg-cc-t-1c | |
| ⬢ 3rd semester 1st half - mathematics - math-g-cc-t-03 | |
| 2021-04-07 | |
| ⬢ 3rd semester 2nd half - education - edcp-cc-t-3 | |
| ⬢ 3rd semester 2nd half - chemistry - chem-g-cc-t-3 | |
| ⬢ 3rd semester 1st half - philosophy - phil-p-cc-t-3 | |
| ⬢ 3rd semester 1st half - molecular biology - mbg-101-t-cc1 | |
| ⬢ 3rd semester 1st half - geography - geo-g-cc-t-03 | |
| 2021-04-05 | |
| ⬢ 3rd semester 2nd half - zoology - zoop-cc-t-03 | |
| ⬢ 3rd semester 2nd half - economics - ecop-cc-t-03 | |
| ⬢ 3rd semester 1st half - urdu - urdp-cc-t-3 | |
| ⬢ 3rd semester 1st half - hindi - hinp-cc-t-3 | |
| ⬢ 3rd semester 1st half - bengali - bngp-cc-t-3 | |
| 2021-04-03 | |
| ⬢ 3rd semester 2nd half - sanskrit - sanp-cc-t-3 | |
| ⬢ 3rd semester 2nd half - defence studies - dfs-g-cc-t-6 | |
| ⬢ 3rd semester 2nd half - defence studies - dfs-g-cc-t-5 | |
| ⬢ 3rd semester 2nd half - arbp-cc-t-1c | |
| ⬢ 3rd SEM- 1st Half - statistics - stat-g-cc-1c | |
| ⬢ 3rd SEM- 1st Half - physiology - physiol-p-cc-03-t | |
| ⬢ 3rd SEM- 1st Half - english - engp-cc-t-3 | |
| 2021-04-01 | |
| ⬢ 3rd sem internal Political Science | |
| ⬢ 3rd SEM- INTERNAL - Zoology HGE | |
| ⬢ 3rd SEM- INTERNAL - Sociology GE | |
| ⬢ 3rd SEM- INTERNAL - Sanskrit HCC & GE | |
| ⬢ 3rd SEM- INTERNAL - Physiology GE | |
| ⬢ 3rd SEM- INTERNAL - Physics SEM. 3 | |
| ⬢ 3rd SEM- INTERNAL - Physical Education General Elective Course(G.E) | |
| ⬢ 3rd SEM- INTERNAL - Philosophy (H & GE) | |
| ⬢ 3rd SEM- INTERNAL - Math-Hons | |
| ⬢ 3rd SEM- INTERNAL - History | |
| ⬢ 3rd SEM- INTERNAL - Geography CC GE & SEC | |
| ⬢ 3rd SEM- INTERNAL - English general internal GE, SEC | |
| ⬢ 3rd SEM- INTERNAL - Education | |
| ⬢ 3rd SEM- INTERNAL - Computer Science HGE | |
| ⬢ 3rd SEM- INTERNAL - Chemistry HCC & HGE | |
| ⬢ 3rd SEM- INTERNAL - Botany Hons | |
| ⬢ 3rd SEM- INTERNAL - Bengali | |
| 2021-03-31 | |
| ⬢ 3rd SEM- SEC 2nd Half Zoology | |
| ⬢ 3rd SEM- SEC 2nd Half - sanskrit - sanh-sec-t-1 | |
| ⬢ 3rd SEM- SEC 2nd Half - political science - plsh-sec-t-1a&b | |
| ⬢ 3rd SEM- SEC 2nd Half - physiology - physiol-h-sec-t-01 | |
| ⬢ 3rd SEM- SEC 2nd Half - physics - phy-h-sec-t-01 | |
| ⬢ 3rd SEM- SEC 2nd Half - philosophy - phil-h-sec-t-1 | |
| ⬢ 3rd SEM- SEC 2nd Half - mathematics - math-h-sec-t-1a&b | |
| ⬢ 3rd SEM- SEC 2nd Half - history - hish-sec-t-1 (a) & (b) | |
| ⬢ 3rd SEM- SEC 2nd Half - english - engh-sec-t-1 | |
| ⬢ 3rd SEM- SEC 2nd Half - education - edu-h-sec-t-1(a&b) | |
| ⬢ 3rd SEM- SEC 2nd Half - economics - ecoh-sec-t-1 | |
| ⬢ 3rd SEM- SEC 2nd Half - chemistry - chem-h-sec-t-1a&b | |
| ⬢ 3rd SEM- SEC 2nd Half - botany - bot-h-sec-t-01a&b | |
| ⬢ 3rd SEM- SEC 2nd Half - bengali - beng-h-sec-t-1 | |
| ⬢ SOCIOLOGY 1ST HALF | |
| ⬢ Political Science GE Question | |
| ⬢ Education SEM-3-EDU-H-GE-T-1 | |
| ⬢ Computer science | |
| ⬢ Sanskrit | |
| ⬢ Political Science | |
| ⬢ Physics | |
| ⬢ Philosophy | |
| ⬢ Mathematics | |
| ⬢ History | |
| ⬢ Geography - geo-h-ge-t-01(c) | |
| ⬢ Geography - geo-h-ge-t-01(b) | |
| ⬢ Geography | |
| ⬢ English | |
| ⬢ Education | |
| ⬢ Economics | |
| ⬢ Chemistry | |
| ⬢ Botany | |
| ⬢ Bengali | |
| 2021-03-26 | |
| ⬢ Sanskrit | |
| ⬢ Political Science | |
| ⬢ Physics | |
| ⬢ Philosophy | |
| ⬢ Mathematics | |
| ⬢ History | |
| ⬢ Geography | |
| ⬢ English | |
| ⬢ Education | |
| ⬢ Economics | |
| ⬢ Chemistry | |
| ⬢ Botany | |
| ⬢ Bengali | |
| 2021-03-25 | |
| ⬢ Sanskrit | |
| ⬢ Political Science | |
| ⬢ Physics | |
| ⬢ Philosophy | |
| ⬢ Mathematics | |
| ⬢ History | |
| ⬢ Geography | |
| ⬢ English | |
| ⬢ Education | |
| ⬢ Economics | |
| ⬢ Chemistry | |
| ⬢ Botany | |
| ⬢ Bengali | |
| 2021-03-24 | |
| ⬢ Sanskrit | |
| ⬢ Political Science | |
| ⬢ Physics | |
| ⬢ Philosophy | |
| ⬢ Mathematics | |
| ⬢ History | |
| ⬢ Geography | |
| ⬢ English | |
| ⬢ Education | |
| ⬢ Economics | |
| ⬢ Chemistry | |
| ⬢ Botany | |
| ⬢ Bengali | |
| 2021-03-22 | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - ZOOLOGY | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - PHYSIOLOGY | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - PHYSICS | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - PHYSICAL EDUCATION | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - GEOGRAPHY | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - COMPUTER SCIENCE | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - CHEMISTRY | |
| ⬢ 5TH SEM PROGRAM [PRAC] QP - BOTANY | |
| 2021-03-21 | |
| ⬢ 5TH SEM - INTERNAL - Zoology-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Sanskrit-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Political Science-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Physiology-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Physics-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Physical Education-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Philosophy-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Mathematics-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - History-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Geogrphy-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - English-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Education-DSE-GE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Computer Science-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Chemistry-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Botany-DSE-SEC | |
| ⬢ 5TH SEM - INTERNAL - Bengali-DSE-GE-SEC | |
| 2021-03-20 | |
| ⬢ 5TH SEM - 2ND HALF - zoology - zool-g-sec-t-03 | |
| ⬢ 5TH SEM - 2ND HALF - sociology - socp-sec-t-3 | |
| ⬢ 5TH SEM - 2ND HALF - sanskrit - sans-p-sec-t-03 | |
| ⬢ 5TH SEM - 2ND HALF - political science - plsp-sec-t-3 | |
| ⬢ 5TH SEM - 2ND HALF - physiology - physiol-g-sec-t-03 | |
| ⬢ 5TH SEM - 2ND HALF - physics - phys(g)sec-t-03 (a to i) | |
| ⬢ 5TH SEM - 2ND HALF - physical education - pedg-sec-t-3 | |
| ⬢ 5TH SEM - 2ND HALF - philosophy - phil-p-sec-t-03 | |
| ⬢ 5TH SEM - 2ND HALF - mathematics - math-g-sec-t-3a&b | |
| ⬢ 5TH SEM - 2ND HALF - history - hisp-sec-t-3(a,b&c) | |
| ⬢ 5TH SEM - 2ND HALF - GEO(G)SEC-P-03(B)-PR | |
| ⬢ 5TH SEM - 2ND HALF - english - engp-sec-t-3 | |
| ⬢ 5TH SEM - 2ND HALF - education - edcp-sec-t-3(a)&(b) | |
| ⬢ 5TH SEM - 2ND HALF - economics - ecop-sec-t-03 | |
| ⬢ 5TH SEM - 2ND HALF - Com.Sc(P)-SEC-P-503-PR(1) | |
| ⬢ 5TH SEM - 2ND HALF - Com.Sc(P)-SEC-P-503-PR (2) | |
| ⬢ 5TH SEM - 2ND HALF - chemistry - chem-g-sec-t-3 | |
| ⬢ 5TH SEM - 2ND HALF - botany - bot-g-sec-t-03a&b | |
| ⬢ 5TH SEM - 2ND HALF - bengali - beng-g-sec-t-3 | |
| ⬢ 5TH SEM - 2ND HALF - arbp-sec-t-3 | |
| ⬢ 5TH SEM - PRACTICAL - PHY(H)-P-DSE-02-PR | |
| ⬢ 5TH SEM - PRACTICAL - PHY(H)-P-DSE-1-PR | |
| ⬢ 5TH SEM - PRACTICAL - PHY(H)-P-DSE-01-PR | |
| ⬢ 5TH SEM - PRACTICAL - CHEM(H)-P-DSE-1B-PR | |
| ⬢ 5TH SEM - PRACTICAL - CHEM(H)-P-DSE-1A-PR | |
| ⬢ 5TH SEM - PRACTICAL - CHEM(H)DSE-P-2C-PR | |
| ⬢ 5TH SEM - PRACTICAL - CHEM(H)DSE-P-2B-PR | |
| ⬢ 5TH SEM - PRACTICAL - CHEM(H)DSE-P-2A-PR | |
| ⬢ 5TH SEM - PRACTICAL - BOTH-DSE-P-02-PR Plant Breeding and Biometry | |
| ⬢ 5TH SEM - PRACTICAL - BOTH-DSE-P-02-PR (B. Stress Biology) | |
| ⬢ 5TH SEM - PRACTICAL - BOTH-DSE-P-01-PR-Industrial & Environmental Microbiology | |
| ⬢ 5TH SEM - PRACTICAL - BOTH-DSE-P-01-PR Analytical Techniques in Plant Science | |
| ⬢ 5TH SEM - 1ST HALF - sociology - socp-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - sanskrit - sanp-ge-t-01 | |
| ⬢ 5TH SEM - 1ST HALF - political science - plsp-ge-t-1(a) & (b) | |
| ⬢ 5TH SEM - 1ST HALF - physical education - pedg-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - philosophy - phil-p-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - history - hisp-ge-t-1,2&3 | |
| ⬢ 5TH SEM - 1ST HALF - geography - geog-ge-t-01 | |
| ⬢ 5TH SEM - 1ST HALF - english - engp-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - education - edcp-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - economics - ecop-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - bengali - beng-g-ge-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - arbp-ge-t-1a | |
| 2021-03-19 | |
| ⬢ 5TH SEM - 2ND HALF - sociology - socp-dse-t-1(a),(b),(c),(d) | |
| ⬢ 5TH SEM - 2ND HALF - computer science - com.sc-g-dse-l-501a | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - physics - phy(h)-p-cc-12-pr | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - physics - phy(h)-p-cc-11-pr | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - geography - geo(h)cc-12-pr | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - chemistry - chem(h)cc-p-12-pr | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - chemistry - chem(h)cc-p-11-pr | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - botany - both-cc-12-pr | |
| ⬢ 5TH SEM - HONS. [PRACTICAL] - botany - both-cc-11-pr | |
| ⬢ 5TH SEM - 1ST HALF - physics - phy-g-dse-t-01 | |
| ⬢ 5TH SEM - 1ST HALF - history - hisp-dse-t-1,2,3 | |
| 2021-03-18 | |
| ⬢ 5TH SEM - 2ND HALF - political science - plsp-dse-t-1(a)&(b) | |
| ⬢ 5TH SEM - 2ND HALF - botany - botg-dse-t-01 (a&b) | |
| ⬢ 5TH SEM - 1ST HALF - MATH - NEW - DSE 1A | |
| ⬢ 5TH SEM - 1ST HALF - physical education - pedg-dse-t-1&2 | |
| ⬢ 5TH SEM - 1ST HALF - mathematics - math-g-dse-t-1b | |
| 2021-03-17 | |
| ⬢ 5TH SEM-2ND HALF - education - edcp-dse-t-1-2(a-d) | |
| ⬢ 5TH SEM-2ND HALF - chemistry - chem-g-dse-t-1 | |
| ⬢ 5TH SEM - 1ST HALF - philosophy - phil-p-dse-t-1a | |
| ⬢ 5TH SEM - 1ST HALF - geography - geog-dse-t-01-a&b | |
| 2021-03-16 | |
| ⬢ 5TH SEM - 2ND HALF - zoology - zool-g-dse-t-01&02 | |
| ⬢ 5TH SEM - 2ND HALF - economics - ecop-dse-t-1a&b | |
| ⬢ 5TH SEM - 1ST HALF - BENGALI - DSE-T-1 | |
| 2021-03-15 | |
| ⬢ 5TH SEM - 2ND HALF - sanskrit - sanp-dse-t-01 | |
| ⬢ 5TH SEM - 2ND HALF - arabic - arbp-dse-t-1a | |
| ⬢ 5TH SEM - 1ST HALF - physiology - phyg-dse-t-2 | |
| ⬢ 5TH SEM - 1ST HALF - english - engp-dse-t-i | |
| 2021-03-14 | |
| ⬢ Sanskrit[h] 5th sem internal | |
| ⬢ Pol. science[h] 5th sem internal | |
| ⬢ Physics[h] 5 th sem internal | |
| ⬢ Philosophy[h] 5th sem internal | |
| ⬢ Mathematics[h] 5th sem internal | |
| ⬢ History[h] 5th sem internal | |
| ⬢ Geography[h] 5th sem internal | |
| ⬢ English[h] 5th sem internal | |
| ⬢ Education[h] 5th sem internal | |
| ⬢ Chemistry[h] 5th sem internal | |
| ⬢ Botany[h] 5th sem internal | |
| ⬢ Bengali[h] 5th sem internal | |
| 2021-03-10 | |
| ⬢ 5TH-SEM - sanskrit - sanh-dse-t-02 | |
| ⬢ 5TH-SEM - sanskrit - sanh-dse-t-01 | |
| ⬢ 5TH-SEM - pol science - plsh-dse-t-2b | |
| ⬢ 5TH-SEM - pol science - plsh-dse-t-2a | |
| ⬢ 5TH-SEM - pol science - plsh-dse-t-1b | |
| ⬢ 5TH-SEM - pol science - plsh-dse-t-1a | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-02 (nuclear and particle physics) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-02 (earth science) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-02 (astronomy and astrophysics) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-02 ( atmospheric physics) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-01 (classical dynamics) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-01 (applied dynamics) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-01 (advanced mathematical physics-ii) | |
| ⬢ 5TH-SEM - physics - phy-h-dse-t-01 (advanced mathematical physics-i) | |
| ⬢ 5TH-SEM - philosophy - phih-dse-t-02 | |
| ⬢ 5TH-SEM - philosophy - phih-dse-t-01 | |
| ⬢ 5TH-SEM - mathematics - math-h-dse-t-2b | |
| ⬢ 5TH-SEM - mathematics - math-h-dse-t-2a | |
| ⬢ 5TH-SEM - mathematics - math-h-dse-t-01a (linear programming) | |
| ⬢ 5TH-SEM - mathematics - math-h-dse-t-01 (point set topology) | |
| ⬢ 5TH-SEM - history - hish-dse-t-3 | |
| ⬢ 5TH-SEM - history - hish-dse-t-2 | |
| ⬢ 5TH-SEM - history - hish-dse-t-1 | |
| ⬢ 5TH-SEM - geography - geo-h-dse-t-02b | |
| ⬢ 5TH-SEM - geography - geo-h-dse-t-02a | |
| ⬢ 5TH-SEM - geography - geo-h-dse-t-01b | |
| ⬢ 5TH-SEM - geography - geo-h-dse-t-01a | |
| ⬢ 5TH-SEM - english - engh-dse-t-3 | |
| ⬢ 5TH-SEM - english - engh-dse-t-2 | |
| ⬢ 5TH-SEM - english - engh-dse-t-1 | |
| ⬢ 5TH-SEM - education - edch-dse-t-1-2(e) | |
| ⬢ 5TH-SEM - education - edch-dse-t-1-2(d) | |
| ⬢ 5TH-SEM - education - edch-dse-t-1-2(c) | |
| ⬢ 5TH-SEM - education - edch-dse-t-1-2(b) | |
| ⬢ 5TH-SEM - education - edch-dse-t-1-2(a) | |
| ⬢ 5TH-SEM - economics - ecoh-dse-t-2b | |
| ⬢ 5TH-SEM - economics - ecoh-dse-t-2a | |
| ⬢ 5TH-SEM - economics - ecoh-dse-t-1b | |
| ⬢ 5TH-SEM - economics - ecoh-dse-t-1a | |
| ⬢ 5TH-SEM - chemistry - chem-h-dse-t-2c | |
| ⬢ 5TH-SEM - chemistry - chem-h-dse-t-2b | |
| ⬢ 5TH-SEM - chemistry - chem-h-dse-t-2a | |
| ⬢ 5TH-SEM - chemistry - chem-h-dse-t-1b | |
| ⬢ 5TH-SEM - chemistry - chem-h-dse-t-1a | |
| ⬢ 5TH-SEM - botany - bot-h-dse-t-02 | |
| ⬢ 5TH-SEM - botany - bot-h-dse-t-01 (industrial and environmental microbiology) | |
| ⬢ 5TH-SEM - botany - bot-h-dse-t-01 (analytical techniques in plant science) | |
| ⬢ 5TH-SEM - bengali - bngh-dse-t-2 | |
| ⬢ 5TH-SEM - bengali - bngh-dse-t-1 | |
| 2021-03-09 | |
| ⬢ 5TH SEM - sanskrit - sanh-cc-t-12 | |
| ⬢ 5TH SEM - political science - plsh-cc-t-12 | |
| ⬢ 5TH SEM - physics - phy-h-cc-t-12 | |
| ⬢ 5TH SEM - philosophy - phih-cc-t-12 | |
| ⬢ 5TH SEM - mathematics - math-h-cc-t-12 | |
| ⬢ 5TH SEM - history - hish-cc-t-12 | |
| ⬢ 5TH SEM - geography - geo-h-cc-t-12 | |
| ⬢ 5TH SEM - english - engh-cc-t-12 | |
| ⬢ 5TH SEM - education - edch-cc-t-12 | |
| ⬢ 5TH SEM - economics - ecoh-cc-t-12 | |
| ⬢ 5TH SEM - chemistry - chem-h-cc-t-12 | |
| ⬢ 5TH SEM - botany - bot-h-cc-t-12 | |
| ⬢ 5TH SEM - bengali - bngh-cc-t-12 | |
| 2021-03-08 | |
| ⬢ 5th sem - sanskrit - sanh-cc-t-11 | |
| ⬢ 5th sem - political science - plsh-cc-t-11 | |
| ⬢ 5th sem - physics - phy-h-cc-t-11 | |
| ⬢ 5th sem - philosophy - phih-cc-t-11 | |
| ⬢ 5th sem - mathematics - math-h-cc-t-11 | |
| ⬢ 5th sem - history - hish-cc-t-11 | |
| ⬢ 5th sem - geography - geo-h-cc-t-11 | |
| ⬢ 5th sem - english - engh-cc-t-11 | |
| ⬢ 5th sem - education - edch-cc-t-11 | |
| ⬢ 5th sem - economics - ecoh-cc-t-11 | |
| ⬢ 5th sem - chemistry - chem-h-cc-t-11 | |
| ⬢ 5th sem - botany - bot-h-cc-t-11 | |
| ⬢ 5th sem - bengali - bngh-cc-t-11 | |
| 2021-02-10 | |
| ⬢ Environmental studies - (compulsory) (for general students) 2nd Half | |
| ⬢ Environmental studies - i (compulsory) (for h & m students) 1st Half | |
| 2021-02-09 | |
| ⬢ English - (engc) (for general students) 2nd Half | |
| ⬢ English - (engc) (for h & m candidates) 1st Half | |
| 2021-02-08 | |
| ⬢ English - (engm) (for general students) 2nd Half | |
| ⬢ Bengali - (bngm) (os) (for general students) 2nd Half | |
| ⬢ Bengali - (bngm) (ns) (for general students) 2nd Half | |
| ⬢ English - (engm) (for h & m students) 1st Half | |
| ⬢ Bengali - (bngm) (os) (for h & m student) 1st Half | |
| ⬢ Bengali - (bngm) (ns) (for h & m students) 1st Half | |
| 2021-02-05 | |
| ⬢ Education - i (ns) (g) 2nd Half | |
| ⬢ Education - i (os) (g) 2nd Half | |
| ⬢ Chemistry - i (g) 2nd Half | |
| ⬢ Philosophy - i (os) (g) 1st Half | |
| ⬢ Philosophy - i (ns) (g) 1st Half | |
| ⬢ Geography - i (os) (g)1st Half | |
| ⬢ Geography - i (ns) (g) 1st Half | |
| 2021-02-04 | |
| ⬢ zoology - i (os) (g) 2nd Half | |
| ⬢ zoology - i (ns) (g) 2nd Half | |
| ⬢ Economics 2nd Half | |
| ⬢ Bengali -i (NS) (g) First half | |
| ⬢ Bengali - i (OS) (g) First half | |
| 2021-02-03 | |
| ⬢ Political science 2nd Half | |
| ⬢ Physical education 1st Half | |
| ⬢ Mathematics 1st Half | |
| ⬢ Botany 1st Half | |
| 2021-02-02 | |
| ⬢ Sociology - i (g) 2nd Half | |
| ⬢ Computer science - i (os) (g) 2nd Half | |
| ⬢ Computer science - i (ns) (g) 2nd Half | |
| ⬢ Physics 1st half | |
| ⬢ History 1st half | |
| 2021-02-01 | |
| ⬢ Sanskrit 2nd Half | |
| ⬢ Arabic 2nd Half | |
| ⬢ Physiology 1st Half | |
| ⬢ English - i (os) (g) 1st Half | |
| ⬢ English - i (ns) (g) 1st Half | |
| 2021-01-30 | |
| ⬢ Sanskrit - ii (h) | |
| ⬢ Political science - ii (h) | |
| ⬢ Physics - ii (h) | |
| ⬢ Philosophy - ii (os) (h) | |
| ⬢ Philosophy - ii (ns) (h) | |
| ⬢ Mathematics - ii (h) | |
| ⬢ History - ii (h) | |
| ⬢ Geography - ii (os) (h) | |
| ⬢ Geography - ii (ns) (h) | |
| ⬢ English - ii (os) (h) | |
| ⬢ English - ii (ns) (h) | |
| ⬢ education - ii (ns) (h) | |
| ⬢ Education - ii (os) (h) | |
| ⬢ Economics - ii (h) | |
| ⬢ Chemistry - ii (h) | |
| ⬢ Botany - ii (h) | |
| ⬢ Bengali - ii (os) (h) | |
| ⬢ Bengali - ii (ns) (h) | |
| 2021-01-28 | |
| ⬢ education - i (ns) (h) | |
| ⬢ Education - i (ns) (h) | |
| ⬢ education - i (os) (h) | |
| ⬢ botany - i (h) | |
| ⬢ economics - i (h) | |
| ⬢ physics - i (h) | |
| ⬢ mathematics - i (h) | |
| ⬢ Chemistry | |
| ⬢ Geography - i (os) (h) | |
| ⬢ Geography - i (ns) (h) | |
| ⬢ Political Science | |
| ⬢ Sanskrit | |
| ⬢ History | |
| ⬢ Philosophy OS | |
| ⬢ Philosophy NS | |
| ⬢ English OS | |
| ⬢ English NS | |
| ⬢ Bengali NS | |
| ⬢ Bengali OS | |
| 2021-01-27 | |
| ⬢ Physical education General practical question | |
| ⬢ Physics General practical question | |
| ⬢ Physiology General practical question | |
| ⬢ Zoology General practical question | |
| ⬢ Chemistry Practical Question | |
| ⬢ Botany Practical Question | |
| ⬢ COMPUTER SCIENCE PRACTICAL 2020 PAPER III GR B[50] | |
| ⬢ COMPUTER SCIENCE PRACTICAL 2020 PAPER II [100] | |
| 2021-01-26 | |
| ⬢ Physics Honours Practical Question | |
| ⬢ Chemistry Honours Practical Question | |
| ⬢ Geography Honours Practical Question | |
| 2021-01-22 | |
| ⬢ Philosophy 2nd Half | |
| ⬢ Philosophy 1st Half | |
| ⬢ Geography 1st Half | |
| 2021-01-21 | |
| ⬢ English 2nd Half | |
| ⬢ Physiology 1st Half | |
| ⬢ English 1st Half | |
